CAS 1251924-50-1 appears in our catalog under these names: (8-Chloroimidazo[1,2-a]pyridin-6-yl)methanol, 95%, {8-chloroimidazo(1,2-a)pyridin-6-yl}methanol, 95%, {8-Chloroimidazo(1,2-a)pyridin-6-yl}methanol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 10g, 50mg, 0,5g.
(8-chloroimidazo[1,2-a]pyridin-6-yl)methanol (CAS 1251924-50-1) is a chemical compound with the molecular formula C8H7ClN2O and a molecular weight of 182.61 g/mol. IUPAC name: (8-chloroimidazo[1,2-a]pyridin-6-yl)methanol. InChIKey: VWRGCSQCPZUJCB-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | (8-chloroimidazo[1,2-a]pyridin-6-yl)methanol |
| InChIKey | VWRGCSQCPZUJCB-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C=C(C2=N1)Cl)CO |
Computed by PubChem (NCBI)