cas: 325780-94-7 — see every product listed under this CAS number, including other names
4-Chloro-5-methyl-2-(methylsulfonyl)pyrimidine, 97% (CAS 325780-94-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210623-100MG |
| cas | 325780-94-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 263.47 Pln | |
| Fluorochem | 250mg | 471.73 Pln | |
| Fluorochem | 1g | 1721.29 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-5-methyl-2-methylsulfonylpyrimidine (CAS 325780-94-7) is a chemical compound with the molecular formula C6H7ClN2O2S and a molecular weight of 206.65 g/mol. IUPAC name: 4-chloro-5-methyl-2-methylsulfonylpyrimidine. InChIKey: WIBJFLAPPUYODA-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O2S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 4-chloro-5-methyl-2-methylsulfonylpyrimidine |
| InChIKey | WIBJFLAPPUYODA-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(N=C1Cl)S(=O)(=O)C |
Computed by PubChem (NCBI)