cas: 625080-60-6 — see every product listed under this CAS number, including other names
4-Chloro-6,7-difluoroquinazoline, 98% (CAS 625080-60-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076915-250MG |
| cas | 625080-60-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1830.62 Pln | |
| Fluorochem | 10g | 2981.26 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-chloro-6,7-difluoroquinazoline (CAS 625080-60-6) is a chemical compound with the molecular formula C8H3ClF2N2 and a molecular weight of 200.57 g/mol. IUPAC name: 4-chloro-6,7-difluoroquinazoline. InChIKey: RFMNNDWGWANMMJ-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF2N2 |
|---|---|
| Molecular weight | 200.57 g/mol |
| IUPAC name | 4-chloro-6,7-difluoroquinazoline |
| InChIKey | RFMNNDWGWANMMJ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)N=CN=C2Cl |
Computed by PubChem (NCBI)