CAS 1388603-94-8 appears in our catalog under these names: 4-Chloro-6,8-difluoroquinazoline, 98%, 4-Chloro-6,8-difluoroquinazoline. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,5g, 50mg.
4-chloro-6,8-difluoroquinazoline (CAS 1388603-94-8) is a chemical compound with the molecular formula C8H3ClF2N2 and a molecular weight of 200.57 g/mol. IUPAC name: 4-chloro-6,8-difluoroquinazoline. InChIKey: WTVWISHRWLIYPS-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF2N2 |
|---|---|
| Molecular weight | 200.57 g/mol |
| IUPAC name | 4-chloro-6,8-difluoroquinazoline |
| InChIKey | WTVWISHRWLIYPS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=NC=N2)Cl)F)F |
Computed by PubChem (NCBI)