cas: 288151-31-5 — see every product listed under this CAS number, including other names
4-Chloro-6,8-difluoro-2-methylquinoline, 98%, 98% (CAS 288151-31-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113WLO-100mg |
| cas | 288151-31-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 280.40 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 674.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-chloro-6,8-difluoro-2-methylquinoline (CAS 288151-31-5) is a chemical compound with the molecular formula C10H6ClF2N and a molecular weight of 213.61 g/mol. IUPAC name: 4-chloro-6,8-difluoro-2-methylquinoline. InChIKey: AFFPXAYTKXVJTD-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF2N |
|---|---|
| Molecular weight | 213.61 g/mol |
| IUPAC name | 4-chloro-6,8-difluoro-2-methylquinoline |
| InChIKey | AFFPXAYTKXVJTD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C=C(C2=N1)F)F)Cl |
Computed by PubChem (NCBI)