Products 288151-28-0
CAS 288151-28-0 is the registry number for 4-Chloro-5,8-difluoro-2-methylquinoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-chloro-5,8-difluoro-2-methylquinoline (CAS 288151-28-0) is a chemical compound with the molecular formula C10H6ClF2N and a molecular weight of 213.61 g/mol. IUPAC name: 4-chloro-5,8-difluoro-2-methylquinoline. InChIKey: WIPKMSXTBJSQHG-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF2N |
|---|---|
| Molecular weight | 213.61 g/mol |
| IUPAC name | 4-chloro-5,8-difluoro-2-methylquinoline |
| InChIKey | WIPKMSXTBJSQHG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC(=C2C(=C1)Cl)F)F |
Computed by PubChem (NCBI)