cas: 625080-60-6 — see every product listed under this CAS number, including other names
4-Chloro-6,7-difluoroquinazoline, 98%, 98% (CAS 625080-60-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ECWS-100mg |
| cas | 625080-60-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 5g | 1571.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-chloro-6,7-difluoroquinazoline (CAS 625080-60-6) is a chemical compound with the molecular formula C8H3ClF2N2 and a molecular weight of 200.57 g/mol. IUPAC name: 4-chloro-6,7-difluoroquinazoline. InChIKey: RFMNNDWGWANMMJ-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF2N2 |
|---|---|
| Molecular weight | 200.57 g/mol |
| IUPAC name | 4-chloro-6,7-difluoroquinazoline |
| InChIKey | RFMNNDWGWANMMJ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)N=CN=C2Cl |
Computed by PubChem (NCBI)