cas: 1939174-71-6 — see every product listed under this CAS number, including other names
4-Chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole 96% (CAS 1939174-71-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A718026-100mg |
| cas | 1939174-71-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 987.81 Pln | |
| Ambeed | 5g | 3212.81 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A718026 |
4-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (CAS 1939174-71-6) is a chemical compound with the molecular formula C13H16BClN2O2 and a molecular weight of 278.54 g/mol. IUPAC name: 4-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole. InChIKey: ZNKLIKIJYRVENU-UHFFFAOYSA-N.
| Molecular formula | C13H16BClN2O2 |
|---|---|
| Molecular weight | 278.54 g/mol |
| IUPAC name | 4-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| InChIKey | ZNKLIKIJYRVENU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=NN3)C(=C2)Cl |
Computed by PubChem (NCBI)