CAS 2172654-42-9 is the registry number for 7-Chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (CAS 2172654-42-9) is a chemical compound with the molecular formula C13H16BClN2O2 and a molecular weight of 278.54 g/mol. IUPAC name: 7-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole. InChIKey: ANRMLYHEWFENLP-UHFFFAOYSA-N.
| Molecular formula | C13H16BClN2O2 |
|---|---|
| Molecular weight | 278.54 g/mol |
| IUPAC name | 7-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| InChIKey | ANRMLYHEWFENLP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C3=C(C=C2)C=NN3)Cl |
Computed by PubChem (NCBI)