cas: 85426-79-5 — see every product listed under this CAS number, including other names
4-Chloro-6-(methylthio)-1H-pyrazolo[3,4-d]pyrimidine 97% (CAS 85426-79-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A618768-100mg |
| cas | 85426-79-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1165.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A618768 |
4-chloro-6-methylsulfanyl-1H-pyrazolo[5,4-d]pyrimidine (CAS 85426-79-5) is a chemical compound with the molecular formula C6H5ClN4S and a molecular weight of 200.65 g/mol. IUPAC name: 4-chloro-6-methylsulfanyl-1H-pyrazolo[5,4-d]pyrimidine. InChIKey: XIGOZRPGXGIKFT-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN4S |
|---|---|
| Molecular weight | 200.65 g/mol |
| IUPAC name | 4-chloro-6-methylsulfanyl-1H-pyrazolo[5,4-d]pyrimidine |
| InChIKey | XIGOZRPGXGIKFT-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(C=NN2)C(=N1)Cl |
Computed by PubChem (NCBI)