CAS 85426-79-5 appears in our catalog under these names: 4-Chloro-6-(methylthio)-1h-pyrazolo[3,4-d]pyrimidine, 95%, 4-Chloro-6-(methylthio)-1H-pyrazolo[3,4-d]pyrimidine, 97%, 97%, 4-CHLORO-6-(METHYLTHIO)-1H-PYRAZOLO[3,4-D]PYRIMIDINE, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
4-chloro-6-methylsulfanyl-1H-pyrazolo[5,4-d]pyrimidine (CAS 85426-79-5) is a chemical compound with the molecular formula C6H5ClN4S and a molecular weight of 200.65 g/mol. IUPAC name: 4-chloro-6-methylsulfanyl-1H-pyrazolo[5,4-d]pyrimidine. InChIKey: XIGOZRPGXGIKFT-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN4S |
|---|---|
| Molecular weight | 200.65 g/mol |
| IUPAC name | 4-chloro-6-methylsulfanyl-1H-pyrazolo[5,4-d]pyrimidine |
| InChIKey | XIGOZRPGXGIKFT-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(C=NN2)C(=N1)Cl |
Computed by PubChem (NCBI)