CAS 1355195-24-2 appears in our catalog under these names: 4–Chloro–6–isopropyl–5,6,7,8–tetrahydropyrido(4,3–d)pyrimidine, 4-Chloro-6-isopropyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine, 97%, 97%, 4-Chloro-6-isopropyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine, 97%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-chloro-6-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (CAS 1355195-24-2) is a chemical compound with the molecular formula C10H14ClN3 and a molecular weight of 211.69 g/mol. IUPAC name: 4-chloro-6-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine. InChIKey: QOYUTSSEVNMVDC-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3 |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | 4-chloro-6-propan-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| InChIKey | QOYUTSSEVNMVDC-UHFFFAOYSA-N |
| SMILES | CC(C)N1CCC2=C(C1)C(=NC=N2)Cl |
Computed by PubChem (NCBI)