Products 88704-73-8

CAS 88704-73-8 is the registry number for 3-(1H-Benzoimidazol-2-yl)propylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg.

Structural formula: {0} (CAS {1})

3-(1H-benzimidazol-2-yl)propan-1-amine;hydrochloride (CAS 88704-73-8) is a chemical compound with the molecular formula C10H14ClN3 and a molecular weight of 211.69 g/mol. IUPAC name: 3-(1H-benzimidazol-2-yl)propan-1-amine;hydrochloride. InChIKey: XIYMDCCAKRWWIU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClN3
Molecular weight211.69 g/mol
IUPAC name3-(1H-benzimidazol-2-yl)propan-1-amine;hydrochloride
InChIKeyXIYMDCCAKRWWIU-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)NC(=N2)CCCN.Cl

Computed by PubChem (NCBI)