4-Chloro-6-phenoxypyrimidine, 95%
cas: 124041-00-5 — see every product listed under this CAS number, including other names
4-Chloro-6-phenoxypyrimidine, 95% (CAS 124041-00-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A514428-250mg |
| cas | 124041-00-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 704.12 Pln | |
| Ambeed | 10g | 1332.69 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 746.00 Pln | |
| Chemat | 10g | 1432.40 Pln | |
| BLDpharm | 100mg | 136.64 Pln | |
| BLDpharm | 1g | 242.16 Pln | |
| BLDpharm | 5g | 758.65 Pln | |
| BLDpharm | 10g | 1447.29 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-chloro-6-phenoxypyrimidine (CAS 124041-00-5) is a chemical compound with the molecular formula C10H7ClN2O and a molecular weight of 206.63 g/mol. IUPAC name: 4-chloro-6-phenoxypyrimidine. InChIKey: KHGWFZBIISKKRP-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O |
|---|---|
| Molecular weight | 206.63 g/mol |
| IUPAC name | 4-chloro-6-phenoxypyrimidine |
| InChIKey | KHGWFZBIISKKRP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=NC=N2)Cl |
Computed by PubChem (NCBI)