cas: 73387-74-3 — see every product listed under this CAS number, including other names
4-Chloro-7-methoxyquinoline-3-carbonitrile 97% (CAS 73387-74-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A223209-100mg |
| cas | 73387-74-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 921.06 Pln | |
| Ambeed | 5g | 3880.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A223209 |
4-chloro-7-methoxyquinoline-3-carbonitrile (CAS 73387-74-3) is a chemical compound with the molecular formula C11H7ClN2O and a molecular weight of 218.64 g/mol. IUPAC name: 4-chloro-7-methoxyquinoline-3-carbonitrile. InChIKey: WMBCMCMNNWELKB-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2O |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 4-chloro-7-methoxyquinoline-3-carbonitrile |
| InChIKey | WMBCMCMNNWELKB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC=C(C(=C2C=C1)Cl)C#N |
Computed by PubChem (NCBI)