cas: 26830-29-5 — see every product listed under this CAS number, including other names
4-Chloro-7-methyl-5,6,7,8-tetrahydropyrido[4',3':4,5]thieno[2,3-d]pyrimidine, 97% (CAS 26830-29-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F695362-100MG |
| cas | 26830-29-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1841.04 Pln | |
| Fluorochem | 250mg | 3600.83 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-chloro-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene (CAS 26830-29-5) is a chemical compound with the molecular formula C10H10ClN3S and a molecular weight of 239.73 g/mol. IUPAC name: 3-chloro-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene. InChIKey: CNMGTRPOXVYQCC-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3S |
|---|---|
| Molecular weight | 239.73 g/mol |
| IUPAC name | 3-chloro-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene |
| InChIKey | CNMGTRPOXVYQCC-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1)SC3=C2C(=NC=N3)Cl |
Computed by PubChem (NCBI)