CAS 1483199-70-7 is the registry number for N-(3-Chlorobenzyl)-3-methyl-1,2,4-thiadiazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(3-chlorophenyl)methyl]-3-methyl-1,2,4-thiadiazol-5-amine (CAS 1483199-70-7) is a chemical compound with the molecular formula C10H10ClN3S and a molecular weight of 239.73 g/mol. IUPAC name: N-[(3-chlorophenyl)methyl]-3-methyl-1,2,4-thiadiazol-5-amine. InChIKey: UZIPBZORVKINBZ-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3S |
|---|---|
| Molecular weight | 239.73 g/mol |
| IUPAC name | N-[(3-chlorophenyl)methyl]-3-methyl-1,2,4-thiadiazol-5-amine |
| InChIKey | UZIPBZORVKINBZ-UHFFFAOYSA-N |
| SMILES | CC1=NSC(=N1)NCC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)