cas: 31602-11-6 — see every product listed under this CAS number, including other names
4-Chloro-8-(trifluoromethyl)quinoline-3-carboxylic acid ethyl ester, 98% (CAS 31602-11-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F614630-250MG |
| cas | 31602-11-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 581.06 Pln | |
| Fluorochem | 1g | 1372.45 Pln | |
| Fluorochem | 5g | 4006.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 4-chloro-8-(trifluoromethyl)quinoline-3-carboxylate (CAS 31602-11-6) is a chemical compound with the molecular formula C13H9ClF3NO2 and a molecular weight of 303.66 g/mol. IUPAC name: ethyl 4-chloro-8-(trifluoromethyl)quinoline-3-carboxylate. InChIKey: CIGIGQHDHKBPAZ-UHFFFAOYSA-N.
| Molecular formula | C13H9ClF3NO2 |
|---|---|
| Molecular weight | 303.66 g/mol |
| IUPAC name | ethyl 4-chloro-8-(trifluoromethyl)quinoline-3-carboxylate |
| InChIKey | CIGIGQHDHKBPAZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C(=C1Cl)C=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)