CAS 31602-11-6 appears in our catalog under these names: 4-Chloro-8-(trifluoromethyl)quinoline-3-carboxylic ethyl ester, 95%, Ethyl 4-Chloro-8-(trifluoromethyl)quinoline-3-carboxylate, 98%, 98%, 4-Chloro-8-(trifluoromethyl)quinoline-3-carboxylic acid ethyl ester, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
Ethyl 4-chloro-8-(trifluoromethyl)quinoline-3-carboxylate (CAS 31602-11-6) is a chemical compound with the molecular formula C13H9ClF3NO2 and a molecular weight of 303.66 g/mol. IUPAC name: ethyl 4-chloro-8-(trifluoromethyl)quinoline-3-carboxylate. InChIKey: CIGIGQHDHKBPAZ-UHFFFAOYSA-N.
| Molecular formula | C13H9ClF3NO2 |
|---|---|
| Molecular weight | 303.66 g/mol |
| IUPAC name | ethyl 4-chloro-8-(trifluoromethyl)quinoline-3-carboxylate |
| InChIKey | CIGIGQHDHKBPAZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C(=C1Cl)C=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)