cas: 79606-45-4 — see every product listed under this CAS number, including other names
4-Chloro-N,N-diisopropylbenzamide, 98%, 98% (CAS 79606-45-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116J0I-1g |
| cas | 79606-45-4 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 107.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-chloro-N,N-di(propan-2-yl)benzamide (CAS 79606-45-4) is a chemical compound with the molecular formula C13H18ClNO and a molecular weight of 239.74 g/mol. IUPAC name: 4-chloro-N,N-di(propan-2-yl)benzamide. InChIKey: MGPPJDHMGGQMSG-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO |
|---|---|
| Molecular weight | 239.74 g/mol |
| IUPAC name | 4-chloro-N,N-di(propan-2-yl)benzamide |
| InChIKey | MGPPJDHMGGQMSG-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)