4-Chloro-N-cyclopentylaniline, 95%
cas: 1019619-33-0 — see every product listed under this CAS number, including other names
4-Chloro-N-cyclopentylaniline, 95% (CAS 1019619-33-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1054129-100mg |
| cas | 1019619-33-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 637.38 Pln | |
| Ambeed | 5g | 1699.81 Pln | |
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 453.20 Pln | |
| Chemat | 5g | 1754.00 Pln | |
| BLDpharm | 100mg | 197.73 Pln | |
| BLDpharm | 250mg | 275.48 Pln | |
| BLDpharm | 1g | 625.36 Pln | |
| BLDpharm | 5g | 1669.44 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-chloro-N-cyclopentylaniline (CAS 1019619-33-0) is a chemical compound with the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. IUPAC name: 4-chloro-N-cyclopentylaniline. InChIKey: PDICLBNBJRYEOF-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | 4-chloro-N-cyclopentylaniline |
| InChIKey | PDICLBNBJRYEOF-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)