CAS 2197056-64-5 appears in our catalog under these names: 7'-Methyl-1',2'-dihydrospiro[cyclopropane-1,3'-indole] hydrochloride, 95%, 7'-Methylspiro(cyclopropane-1,3'-indoline) hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
7-methylspiro[1,2-dihydroindole-3,1'-cyclopropane];hydrochloride (CAS 2197056-64-5) is a chemical compound with the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. IUPAC name: 7-methylspiro[1,2-dihydroindole-3,1'-cyclopropane];hydrochloride. InChIKey: WLYINJXJYYXFQQ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | 7-methylspiro[1,2-dihydroindole-3,1'-cyclopropane];hydrochloride |
| InChIKey | WLYINJXJYYXFQQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C3(CC3)CN2.Cl |
Computed by PubChem (NCBI)