cas: 98-60-2 — see every product listed under this CAS number, including other names
4-Chlorobenzene-1-sulfonyl chloride, 95% (CAS 98-60-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F318265-1G |
| cas | 98-60-2 |
| size | 1g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 143.72 Pln | |
| Fluorochem | 250g | 268.67 Pln | |
| Fluorochem | 500g | 414.46 Pln | |
| Fluorochem | 1kg | 763.29 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
4-chlorobenzenesulfonyl chloride (CAS 98-60-2) is a chemical compound with the molecular formula C6H4Cl2O2S and a molecular weight of 211.06 g/mol. IUPAC name: 4-chlorobenzenesulfonyl chloride. InChIKey: ZLYBFBAHAQEEQQ-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2O2S |
|---|---|
| Molecular weight | 211.06 g/mol |
| IUPAC name | 4-chlorobenzenesulfonyl chloride |
| InChIKey | ZLYBFBAHAQEEQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)