CAS 498-60-2 appears in our catalog under these names: 3-Furaldehyde, 98%, stabilized, 3-(3-(Trifluoromethyl)-3H-diazirin-3-yl)pyrrolidine hydrochloride, 98%, 98%, 4-Chlorobenzenesulfonyl Chloride, 4-Chlorobenzenesulfonyl chloride, 97%, 4-Chlorobenzenesulfonyl chloride 96%. Offered by: Thermo Scientific (Acros), Chemat, TRC, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 5g, 25g, 50mg, 100mg, 250mg, 10g, 100g.
4-chlorobenzenesulfonyl chloride (CAS 98-60-2) is a chemical compound with the molecular formula C6H4Cl2O2S and a molecular weight of 211.06 g/mol. IUPAC name: 4-chlorobenzenesulfonyl chloride. InChIKey: ZLYBFBAHAQEEQQ-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2O2S |
|---|---|
| Molecular weight | 211.06 g/mol |
| IUPAC name | 4-chlorobenzenesulfonyl chloride |
| InChIKey | ZLYBFBAHAQEEQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)