CAS 36822-09-0 appears in our catalog under these names: 4-Chlorobenzo[4,5]thieno[3,2-d]pyrimidine, 97%, 97%, 4-Chlorobenzo[4,5]thieno[3,2-d]pyrimidine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
4-chloro-[1]benzothiolo[3,2-d]pyrimidine (CAS 36822-09-0) is a chemical compound with the molecular formula C10H5ClN2S and a molecular weight of 220.68 g/mol. IUPAC name: 4-chloro-[1]benzothiolo[3,2-d]pyrimidine. InChIKey: GRJAFENSUSLYET-UHFFFAOYSA-N.
| Molecular formula | C10H5ClN2S |
|---|---|
| Molecular weight | 220.68 g/mol |
| IUPAC name | 4-chloro-[1]benzothiolo[3,2-d]pyrimidine |
| InChIKey | GRJAFENSUSLYET-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)C(=NC=N3)Cl |
Computed by PubChem (NCBI)