CAS 40142-92-5 appears in our catalog under these names: 4-Chlorobenzo(4,5)thieno(2,3-d)pyrimidine, 95+%, 4-chlorobenzo(4,5)thieno(2,3-d)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-chloro-[1]benzothiolo[2,3-d]pyrimidine (CAS 40142-92-5) is a chemical compound with the molecular formula C10H5ClN2S and a molecular weight of 220.68 g/mol. IUPAC name: 4-chloro-[1]benzothiolo[2,3-d]pyrimidine. InChIKey: XZLIYHJQECJFSZ-UHFFFAOYSA-N.
| Molecular formula | C10H5ClN2S |
|---|---|
| Molecular weight | 220.68 g/mol |
| IUPAC name | 4-chloro-[1]benzothiolo[2,3-d]pyrimidine |
| InChIKey | XZLIYHJQECJFSZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)N=CN=C3Cl |
Computed by PubChem (NCBI)