cas: 671215-76-2 — see every product listed under this CAS number, including other names
4-Chloromethyl-2-(2-fluoro-phenyl)-5-methyl-oxazole, 95%, 95% (CAS 671215-76-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117LGE-100mg |
| cas | 671215-76-2 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(chloromethyl)-2-(2-fluorophenyl)-5-methyl-1,3-oxazole (CAS 671215-76-2) is a chemical compound with the molecular formula C11H9ClFNO and a molecular weight of 225.64 g/mol. IUPAC name: 4-(chloromethyl)-2-(2-fluorophenyl)-5-methyl-1,3-oxazole. InChIKey: FPUOUVIUAUPHRS-UHFFFAOYSA-N.
| Molecular formula | C11H9ClFNO |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(2-fluorophenyl)-5-methyl-1,3-oxazole |
| InChIKey | FPUOUVIUAUPHRS-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=CC=C2F)CCl |
Computed by PubChem (NCBI)