CAS 884504-76-1 appears in our catalog under these names: 4-(Chloromethyl)-2-(3-fluorophenyl)-5-methyl-1,3-oxazole, 95%, 4-(Chloromethyl)-2-(3-fluorophenyl)-5-methyloxazole, 95+%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, on request.
4-(chloromethyl)-2-(3-fluorophenyl)-5-methyl-1,3-oxazole (CAS 884504-76-1) is a chemical compound with the molecular formula C11H9ClFNO and a molecular weight of 225.64 g/mol. IUPAC name: 4-(chloromethyl)-2-(3-fluorophenyl)-5-methyl-1,3-oxazole. InChIKey: QOZYCDPIFFXHKK-UHFFFAOYSA-N.
| Molecular formula | C11H9ClFNO |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(3-fluorophenyl)-5-methyl-1,3-oxazole |
| InChIKey | QOZYCDPIFFXHKK-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC(=CC=C2)F)CCl |
Computed by PubChem (NCBI)