CAS 873-77-8 appears in our catalog under these names: 4-Chlorophenylmagnesium bromide, 1M solution in THF/toluene, AcroSeal®, 4-CHLOROPHENYLMAGNESIUM BROMIDE SOLUTIO&, 4-CHLOROPHENYLMAGNESIUM BROMIDE, 1.0M SO, 4-CHLOROPHENYLMAGNESIUM BROMIDE,. Offered by: Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 100ML, 800ML, 4X25ML.
Magnesium;chlorobenzene;bromide (CAS 873-77-8) is a chemical compound with the molecular formula C6H4BrClMg and a molecular weight of 215.76 g/mol. IUPAC name: magnesium;chlorobenzene;bromide. InChIKey: DLJIPJMUYCUTOV-UHFFFAOYSA-M.
| Molecular formula | C6H4BrClMg |
|---|---|
| Molecular weight | 215.76 g/mol |
| IUPAC name | magnesium;chlorobenzene;bromide |
| InChIKey | DLJIPJMUYCUTOV-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=[C-]1)Cl.[Mg+2].[Br-] |
Computed by PubChem (NCBI)