cas: 1400688-73-4 — see every product listed under this CAS number, including other names
4-Chloropyrrolo(1,2-b)pyridazine-3-carboxylic acid, 95+% (CAS 1400688-73-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A255973-5g |
| cas | 1400688-73-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 22920.10 Pln | |
| AmBeed | 1g | 7686.70 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-chloropyrrolo[1,2-b]pyridazine-3-carboxylic acid (CAS 1400688-73-4) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 4-chloropyrrolo[1,2-b]pyridazine-3-carboxylic acid. InChIKey: YWLBDEYWEUPPQA-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 4-chloropyrrolo[1,2-b]pyridazine-3-carboxylic acid |
| InChIKey | YWLBDEYWEUPPQA-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1)C(=C(C=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)