Products 1400688-73-4
CAS 1400688-73-4 appears in our catalog under these names: 4-Chloropyrrolo(1,2-b)pyridazine-3-carboxylic acid, 4-Chloropyrrolo[1,2-b]pyridazine-3-carboxylic acid, 95%, 4-Chloropyrrolo(1,2-b)pyridazine-3-carboxylic acid, 95+%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 50mg, 0,5g, 250mg, 1g, 5g.
4-chloropyrrolo[1,2-b]pyridazine-3-carboxylic acid (CAS 1400688-73-4) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 4-chloropyrrolo[1,2-b]pyridazine-3-carboxylic acid. InChIKey: YWLBDEYWEUPPQA-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 4-chloropyrrolo[1,2-b]pyridazine-3-carboxylic acid |
| InChIKey | YWLBDEYWEUPPQA-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1)C(=C(C=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)