cas: 219763-83-4 — see every product listed under this CAS number, including other names
4-Chloroquinoline-6-carbonitrile 98% (CAS 219763-83-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A809063-100mg |
| cas | 219763-83-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 453.81 Pln | |
| Ambeed | 250mg | 654.06 Pln | |
| Ambeed | 1g | 1827.75 Pln | |
| Ambeed | 5g | 6160.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A809063 |
4-chloroquinoline-6-carbonitrile (CAS 219763-83-4) is a chemical compound with the molecular formula C10H5ClN2 and a molecular weight of 188.61 g/mol. IUPAC name: 4-chloroquinoline-6-carbonitrile. InChIKey: FLRGXIDFVYOCLP-UHFFFAOYSA-N.
| Molecular formula | C10H5ClN2 |
|---|---|
| Molecular weight | 188.61 g/mol |
| IUPAC name | 4-chloroquinoline-6-carbonitrile |
| InChIKey | FLRGXIDFVYOCLP-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CC(=C2C=C1C#N)Cl |
Computed by PubChem (NCBI)