cas: 219763-83-4 — see every product listed under this CAS number, including other names
4-Chloroquinoline-6-carbonitrile, 96%, 96% (CAS 219763-83-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118OJO-50mg |
| cas | 219763-83-4 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 237.20 Pln | |
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 506.00 Pln | |
| Chemat | 1g | 1418.00 Pln | |
| Chemat | 5g | 4912.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
4-chloroquinoline-6-carbonitrile (CAS 219763-83-4) is a chemical compound with the molecular formula C10H5ClN2 and a molecular weight of 188.61 g/mol. IUPAC name: 4-chloroquinoline-6-carbonitrile. InChIKey: FLRGXIDFVYOCLP-UHFFFAOYSA-N.
| Molecular formula | C10H5ClN2 |
|---|---|
| Molecular weight | 188.61 g/mol |
| IUPAC name | 4-chloroquinoline-6-carbonitrile |
| InChIKey | FLRGXIDFVYOCLP-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CC(=C2C=C1C#N)Cl |
Computed by PubChem (NCBI)