4-Chloroquinoline-8-carboxylic acid 98%
cas: 216257-37-3 — see every product listed under this CAS number, including other names
4-Chloroquinoline-8-carboxylic acid 98% (CAS 216257-37-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A350271-100mg |
| cas | 216257-37-3 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 481.62 Pln | |
| Ambeed | 250mg | 615.13 Pln | |
| Ambeed | 1g | 1327.12 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A350271 |
4-chloroquinoline-8-carboxylic acid (CAS 216257-37-3) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 4-chloroquinoline-8-carboxylic acid. InChIKey: QLGATRTYRGPJDU-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 4-chloroquinoline-8-carboxylic acid |
| InChIKey | QLGATRTYRGPJDU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C(=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)