CAS 1824065-62-4 appears in our catalog under these names: 8-Chloroisoquinoline-4-carboxylic acid, 8-Chloroisoquinoline-4-carboxylic acid, 95%, 8-Chloroisoquinoline-4-carboxylic acid, 95%, 95%. Offered by: Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 50mg, 0,5g, 250mg, 1g, 100mg.
8-chloroisoquinoline-4-carboxylic acid (CAS 1824065-62-4) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 8-chloroisoquinoline-4-carboxylic acid. InChIKey: LBEGXYDMCQMRPE-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 8-chloroisoquinoline-4-carboxylic acid |
| InChIKey | LBEGXYDMCQMRPE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NC=C2C(=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)