CAS 1975-53-7 appears in our catalog under these names: 4-Cyano-2-methylbenzoic acid, 4-Cyano-2-methylbenzoic acid, 96%, 96%, 4-Cyano-2-methylbenzoic acid, 97%, 4-Cyano-2-methylbenzoic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 50g, 100mg, 1g, 10g, 25g, 100g.
4-cyano-2-methylbenzoic acid (CAS 1975-53-7) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 4-cyano-2-methylbenzoic acid. InChIKey: NIDKGLRXRBFGEN-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 4-cyano-2-methylbenzoic acid |
| InChIKey | NIDKGLRXRBFGEN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C#N)C(=O)O |
Computed by PubChem (NCBI)