cas: 23313-80-6 — see every product listed under this CAS number, including other names
4-Epitetracycline Hydrochloride (CAS 23313-80-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 10mg, 1mg, 5mg, 25mg, 2mg, 1EA, 1x10mg. Offered by: Mikromol, Dr. Ehrenstorfer, TargetMol, Biosynth.
| brand | Mikromol |
|---|---|
| catalog number | MM0452.01 |
| cas | 23313-80-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Mikromol | 50mg | price on request | |
| Dr. Ehrenstorfer | 10mg | price on request | |
| TargetMol | 1mg | 665.09 Pln | |
| TargetMol | 5mg | 1329.18 Pln | |
| TargetMol | 10mg | 1866.94 Pln | |
| TargetMol | 25mg | 3540.58 Pln | |
| TargetMol | 50mg | 5805.09 Pln | |
| Biosynth | 2mg | price on request | |
| Biosynth | 5mg | price on request | |
| Biosynth | 10mg | price on request | |
| Biosynth | 25mg | price on request | |
| Biosynth | 50mg | price on request | |
| Sigma-Aldrich | 1EA | 960.50 Pln | |
| HPC Standards | 1x10mg | 691.96 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(4R,4aS,5aS,6S,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride (CAS 23313-80-6) is a chemical compound with the molecular formula C22H25ClN2O8 and a molecular weight of 480.9 g/mol. IUPAC name: (4R,4aS,5aS,6S,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride. InChIKey: YCIHPQHVWDULOY-DXDJYCPMSA-N.
| Molecular formula | C22H25ClN2O8 |
|---|---|
| Molecular weight | 480.9 g/mol |
| IUPAC name | (4R,4aS,5aS,6S,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride |
| InChIKey | YCIHPQHVWDULOY-DXDJYCPMSA-N |
| SMILES | C[C@@]1([C@H]2C[C@H]3[C@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O.Cl |
Computed by PubChem (NCBI)