cas: 23313-80-6 — see every product listed under this CAS number, including other names
Epitetracycline (hydrochloride), 98%, 98% (CAS 23313-80-6) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LAX-5mg |
| cas | 23313-80-6 |
| size | 5mg |
| availability | 0.05g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 630.80 Pln | |
| Chemat | 25mg | 2128.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4R,4aS,5aS,6S,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride (CAS 23313-80-6) is a chemical compound with the molecular formula C22H25ClN2O8 and a molecular weight of 480.9 g/mol. IUPAC name: (4R,4aS,5aS,6S,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride. InChIKey: YCIHPQHVWDULOY-DXDJYCPMSA-N.
| Molecular formula | C22H25ClN2O8 |
|---|---|
| Molecular weight | 480.9 g/mol |
| IUPAC name | (4R,4aS,5aS,6S,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride |
| InChIKey | YCIHPQHVWDULOY-DXDJYCPMSA-N |
| SMILES | C[C@@]1([C@H]2C[C@H]3[C@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O.Cl |
Computed by PubChem (NCBI)