cas: 886037-78-1 — see every product listed under this CAS number, including other names
4-Ethoxy-2,3-difluoro-6-methylphenol 97% (CAS 886037-78-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A372766-100mg |
| cas | 886037-78-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 654.06 Pln | |
| Ambeed | 5g | 1883.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A372766 |
4-ethoxy-2,3-difluoro-6-methylphenol (CAS 886037-78-1) is a chemical compound with the molecular formula C9H10F2O2 and a molecular weight of 188.17 g/mol. IUPAC name: 4-ethoxy-2,3-difluoro-6-methylphenol. InChIKey: PADWOKYXWPRBPJ-UHFFFAOYSA-N.
| Molecular formula | C9H10F2O2 |
|---|---|
| Molecular weight | 188.17 g/mol |
| IUPAC name | 4-ethoxy-2,3-difluoro-6-methylphenol |
| InChIKey | PADWOKYXWPRBPJ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C(=C1)C)O)F)F |
Computed by PubChem (NCBI)