CAS 1881320-89-3 is the registry number for 2,4-difluoro-5-(propan-2-yloxy)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,4-difluoro-5-propan-2-yloxyphenol (CAS 1881320-89-3) is a chemical compound with the molecular formula C9H10F2O2 and a molecular weight of 188.17 g/mol. IUPAC name: 2,4-difluoro-5-propan-2-yloxyphenol. InChIKey: ODEBNJWCDCYEDI-UHFFFAOYSA-N.
| Molecular formula | C9H10F2O2 |
|---|---|
| Molecular weight | 188.17 g/mol |
| IUPAC name | 2,4-difluoro-5-propan-2-yloxyphenol |
| InChIKey | ODEBNJWCDCYEDI-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C(=C1)O)F)F |
Computed by PubChem (NCBI)