4-Ethyl-4,9-dihydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione, 99%, 99%
cas: 64439-81-2 — see every product listed under this CAS number, including other names
4-Ethyl-4,9-dihydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione, 99%, 99% (CAS 64439-81-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IBD7-100mg |
| cas | 64439-81-2 |
| size | 100mg |
| availability | 15g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 702.80 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
19-ethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione (CAS 64439-81-2) is a chemical compound with the molecular formula C20H16N2O5 and a molecular weight of 364.4 g/mol. IUPAC name: 19-ethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione. InChIKey: HAWSQZCWOQZXHI-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O5 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 19-ethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione |
| InChIKey | HAWSQZCWOQZXHI-UHFFFAOYSA-N |
| SMILES | CCC1(C2=C(COC1=O)C(=O)N3CC4=C(C3=C2)N=C5C=CC(=CC5=C4)O)O |
Computed by PubChem (NCBI)