cas: 64439-81-2 — see every product listed under this CAS number, including other names
(±)-10-Hydroxycamptothecin 98% (CAS 64439-81-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 25mg, 50mg, 100mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A314756-1mg |
| cas | 64439-81-2 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 142.31 Pln | |
| Ambeed | 10mg | 192.38 Pln | |
| Ambeed | 25mg | 214.62 Pln | |
| Ambeed | 50mg | 248.00 Pln | |
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 1g | 348.12 Pln | |
| Ambeed | 5g | 1032.31 Pln | |
| Ambeed | 25g | 3429.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A314756 |
19-ethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione (CAS 64439-81-2) is a chemical compound with the molecular formula C20H16N2O5 and a molecular weight of 364.4 g/mol. IUPAC name: 19-ethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione. InChIKey: HAWSQZCWOQZXHI-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O5 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 19-ethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione |
| InChIKey | HAWSQZCWOQZXHI-UHFFFAOYSA-N |
| SMILES | CCC1(C2=C(COC1=O)C(=O)N3CC4=C(C3=C2)N=C5C=CC(=CC5=C4)O)O |
Computed by PubChem (NCBI)