cas: 1217628-46-0 — see every product listed under this CAS number, including other names
4-FMOC-PIPERAZINE-2-(S)-CARBOXYLIC ACID, 96%, 96% (CAS 1217628-46-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1126U4-100mg |
| cas | 1217628-46-0 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 410.00 Pln | |
| Chemat | 250mg | 573.20 Pln | |
| Chemat | 1g | 1250.00 Pln | |
| Chemat | 5g | 3573.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(2S)-4-(9H-fluoren-9-ylmethoxycarbonyl)piperazine-2-carboxylic acid (CAS 1217628-46-0) is a chemical compound with the molecular formula C20H20N2O4 and a molecular weight of 352.4 g/mol. IUPAC name: (2S)-4-(9H-fluoren-9-ylmethoxycarbonyl)piperazine-2-carboxylic acid. InChIKey: MVXOLCRCKMWZCB-SFHVURJKSA-N.
| Molecular formula | C20H20N2O4 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | (2S)-4-(9H-fluoren-9-ylmethoxycarbonyl)piperazine-2-carboxylic acid |
| InChIKey | MVXOLCRCKMWZCB-SFHVURJKSA-N |
| SMILES | C1CN(C[C@H](N1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)