CAS 1217628-46-0 appears in our catalog under these names: 4-Fmoc-piperazine-2-(s)-carboxylic acid, 95%, 4-FMOC-PIPERAZINE-2-(S)-CARBOXYLIC ACID, 96%, 96%. Offered by: Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-4-(9H-fluoren-9-ylmethoxycarbonyl)piperazine-2-carboxylic acid (CAS 1217628-46-0) is a chemical compound with the molecular formula C20H20N2O4 and a molecular weight of 352.4 g/mol. IUPAC name: (2S)-4-(9H-fluoren-9-ylmethoxycarbonyl)piperazine-2-carboxylic acid. InChIKey: MVXOLCRCKMWZCB-SFHVURJKSA-N.
| Molecular formula | C20H20N2O4 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | (2S)-4-(9H-fluoren-9-ylmethoxycarbonyl)piperazine-2-carboxylic acid |
| InChIKey | MVXOLCRCKMWZCB-SFHVURJKSA-N |
| SMILES | C1CN(C[C@H](N1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)