cas: 364-53-4 — see every product listed under this CAS number, including other names
4-Fluoro-1,2-dinitrobenzene 98% (CAS 364-53-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A729909-1g |
| cas | 364-53-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 25g | 609.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A729909 |
4-fluoro-1,2-dinitrobenzene (CAS 364-53-4) is a chemical compound with the molecular formula C6H3FN2O4 and a molecular weight of 186.10 g/mol. IUPAC name: 4-fluoro-1,2-dinitrobenzene. InChIKey: IRIUWJQQUVBRLV-UHFFFAOYSA-N.
| Molecular formula | C6H3FN2O4 |
|---|---|
| Molecular weight | 186.10 g/mol |
| IUPAC name | 4-fluoro-1,2-dinitrobenzene |
| InChIKey | IRIUWJQQUVBRLV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)