CAS 364-53-4 appears in our catalog under these names: 4-Fluoro-1,2-dinitrobenzene 98%, 3,4-Dinitrofluorobenzene, 96%, 3,4–Dinitrofluorobenzene, 3,4-Dinitrofluorobenzene. Offered by: Ambeed, Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 250mg.
4-fluoro-1,2-dinitrobenzene (CAS 364-53-4) is a chemical compound with the molecular formula C6H3FN2O4 and a molecular weight of 186.10 g/mol. IUPAC name: 4-fluoro-1,2-dinitrobenzene. InChIKey: IRIUWJQQUVBRLV-UHFFFAOYSA-N.
| Molecular formula | C6H3FN2O4 |
|---|---|
| Molecular weight | 186.10 g/mol |
| IUPAC name | 4-fluoro-1,2-dinitrobenzene |
| InChIKey | IRIUWJQQUVBRLV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)