cas: 683748-50-7 — see every product listed under this CAS number, including other names
4-Fluoro-1H-indazol-3-ol, 95%, 95% (CAS 683748-50-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FA98-1g |
| cas | 683748-50-7 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 280.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-fluoro-1,2-dihydroindazol-3-one (CAS 683748-50-7) is a chemical compound with the molecular formula C7H5FN2O and a molecular weight of 152.13 g/mol. IUPAC name: 4-fluoro-1,2-dihydroindazol-3-one. InChIKey: IPWWMTIKWNMANU-UHFFFAOYSA-N.
| Molecular formula | C7H5FN2O |
|---|---|
| Molecular weight | 152.13 g/mol |
| IUPAC name | 4-fluoro-1,2-dihydroindazol-3-one |
| InChIKey | IPWWMTIKWNMANU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=O)NN2 |
Computed by PubChem (NCBI)