CAS 683748-50-7 appears in our catalog under these names: 3H-Indazol-3-one, 4-fluoro-1,2-dihydro-, 95%, 4–Fluoro–1H–indazol–3–ol, 4-Fluoro-1H-indazol-3-ol 95%, 4-Fluoro-1H-indazol-3-ol, 95%, 95%, 4-Fluoro-1,2-dihydro-Indazol-3-one, 95+%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 25g.
4-fluoro-1,2-dihydroindazol-3-one (CAS 683748-50-7) is a chemical compound with the molecular formula C7H5FN2O and a molecular weight of 152.13 g/mol. IUPAC name: 4-fluoro-1,2-dihydroindazol-3-one. InChIKey: IPWWMTIKWNMANU-UHFFFAOYSA-N.
| Molecular formula | C7H5FN2O |
|---|---|
| Molecular weight | 152.13 g/mol |
| IUPAC name | 4-fluoro-1,2-dihydroindazol-3-one |
| InChIKey | IPWWMTIKWNMANU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=O)NN2 |
Computed by PubChem (NCBI)