cas: 863578-24-9 — see every product listed under this CAS number, including other names
4-Fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline 95% (CAS 863578-24-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A768058-100mg |
| cas | 863578-24-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 364.81 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1193.62 Pln | |
| Ambeed | 5g | 4013.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A768058 |
4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 863578-24-9) is a chemical compound with the molecular formula C12H17BFNO2 and a molecular weight of 237.08 g/mol. IUPAC name: 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: RLUKWTHMONYTKG-UHFFFAOYSA-N.
| Molecular formula | C12H17BFNO2 |
|---|---|
| Molecular weight | 237.08 g/mol |
| IUPAC name | 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | RLUKWTHMONYTKG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)N |
Computed by PubChem (NCBI)