cas: 383-31-3 — see every product listed under this CAS number, including other names
4-Fluoro-N,N-dimethylbenzenesulfonamide, 98% (CAS 383-31-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210532-1G |
| cas | 383-31-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 560.24 Pln | |
| Fluorochem | 10g | 1060.06 Pln | |
| Fluorochem | 25g | 1934.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-fluoro-N,N-dimethylbenzenesulfonamide (CAS 383-31-3) is a chemical compound with the molecular formula C8H10FNO2S and a molecular weight of 203.24 g/mol. IUPAC name: 4-fluoro-N,N-dimethylbenzenesulfonamide. InChIKey: WURMPFYVFDHATI-UHFFFAOYSA-N.
| Molecular formula | C8H10FNO2S |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 4-fluoro-N,N-dimethylbenzenesulfonamide |
| InChIKey | WURMPFYVFDHATI-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)